C17H31N3O3 — CID 22973017
3-pyrrolidin-1-ylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate (PubChem CID 22973017) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate.
| Compound Name | 3-pyrrolidin-1-ylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
|---|---|
| PubChem CID | 22973017 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
| SMILES | CC(C)(C)/C(=N/C(=O)OCCCN1CCCC1)N1CCOCC1 |
| InChI | InChI=1S/C17H31N3O3/c1-17(2,3)15(20-10-13-22-14-11-20)18-16(21)23-12-6-9-19-7-4-5-8-19/h4-14H2,1-3H3/b18-15- |
| InChIKey | BWRKFEFDIKQYGB-SDXDJHTJSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|