C15H26N2O4 — CID 71148450
oxolan-3-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate (PubChem CID 71148450) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is oxolan-3-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate.
| Compound Name | oxolan-3-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
|---|---|
| PubChem CID | 71148450 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | oxolan-3-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
| SMILES | CC(C)(C)C(=NC(=O)OCC1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C15H26N2O4/c1-15(2,3)13(17-5-8-19-9-6-17)16-14(18)21-11-12-4-7-20-10-12/h12H,4-11H2,1-3H3 |
| InChIKey | MJAPJQBBSXFPKP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|