About oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate
oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate (PubChem CID 71154595) has the molecular formula C14H24N2O4
and a molecular weight of 284.36 g/mol. Its IUPAC name is oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate |
| PubChem CID | 71154595 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate |
| SMILES | CCC(=NC(=O)OCC1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C14H24N2O4/c1-2-13(16-5-9-19-10-6-16)15-14(17)20-11-12-3-7-18-8-4-12/h12H,2-11H2,1H3 |
| InChIKey | INHYHNVKKFXBHT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate?
The IUPAC name of oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate (CID 71154595) is oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate.
What is the SMILES notation for oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate?
The canonical SMILES for oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate is CCC(=NC(=O)OCC1CCOCC1)N1CCOCC1.
What is the InChIKey of oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate?
The InChIKey is INHYHNVKKFXBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O4/c1-2-13(16-5-9-19-10-6-16)15-14(17)20-11-12-3-7-18-8-4-12/h12H,2-11H2,1H3.
What are the key properties of oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate?
oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate has a molecular weight of 284.36 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl N-(1-morpholin-4-ylpropylidene)carbamate is sourced from PubChem (CID 71154595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).