C15H22N2O4 — CID 142228150
3,4-dihydro-2H-pyran-4-ylmethyl (NZ)-N-(2-methyl-1-morpholin-4-ylprop-2-enylidene)carbamate (PubChem CID 142228150) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-4-ylmethyl (NZ)-N-(2-methyl-1-morpholin-4-ylprop-2-enylidene)carbamate.
| Compound Name | 3,4-dihydro-2H-pyran-4-ylmethyl (NZ)-N-(2-methyl-1-morpholin-4-ylprop-2-enylidene)carbamate |
|---|---|
| PubChem CID | 142228150 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3,4-dihydro-2H-pyran-4-ylmethyl (NZ)-N-(2-methyl-1-morpholin-4-ylprop-2-enylidene)carbamate |
| SMILES | C=C(C)/C(=N/C(=O)OCC1C=COCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H22N2O4/c1-12(2)14(17-5-9-20-10-6-17)16-15(18)21-11-13-3-7-19-8-4-13/h3,7,13H,1,4-6,8-11H2,2H3/b16-14- |
| InChIKey | ZIILZXFLYRWDGZ-PEZBUJJGSA-N |
| XLogP | 1.98 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|