C16H28N2O4 — CID 71148449
oxan-4-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate (PubChem CID 71148449) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is oxan-4-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate.
| Compound Name | oxan-4-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
|---|---|
| PubChem CID | 71148449 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | oxan-4-ylmethyl N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
| SMILES | CC(C)(C)C(=NC(=O)OCC1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C16H28N2O4/c1-16(2,3)14(18-6-10-21-11-7-18)17-15(19)22-12-13-4-8-20-9-5-13/h13H,4-12H2,1-3H3 |
| InChIKey | VCQYNQQENMIKGW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|