About CID 59042175
CID 59042175 (PubChem CID 59042175) has the molecular formula C14H22AlO4
and a molecular weight of 281.31 g/mol.
Molecular Properties
| Compound Name | CID 59042175 |
| PubChem CID | 59042175 |
| Molecular Formula | C14H22AlO4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | — |
| SMILES | CC/C(C(C)=O)=C(\C)O[Al]O/C(C)=C(/CC)C(C)=O |
| InChI | InChI=1S/2C7H12O2.Al/c2*1-4-7(5(2)8)6(3)9;/h2*8H,4H2,1-3H3;/q;;+2/p-2/b2*7-5-; |
| InChIKey | BQBUVMBMSDJPNT-AGRVASMDSA-L |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59042175 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59042175?
The IUPAC name of CID 59042175 (CID 59042175) is not available.
What is the SMILES notation for CID 59042175?
The canonical SMILES for CID 59042175 is CC/C(C(C)=O)=C(\C)O[Al]O/C(C)=C(/CC)C(C)=O.
What is the InChIKey of CID 59042175?
The InChIKey is BQBUVMBMSDJPNT-AGRVASMDSA-L. The full InChI is InChI=1S/2C7H12O2.Al/c2*1-4-7(5(2)8)6(3)9;/h2*8H,4H2,1-3H3;/q;;+2/p-2/b2*7-5-;.
What are the key properties of CID 59042175?
CID 59042175 has a molecular weight of 281.31 g/mol, XLogP of 3.10, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59042175 is sourced from PubChem (CID 59042175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).