C10H11BF2O2S — CID 59043672
(2R)-2-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1-(3,4-difluorophenyl)propan-1-one (PubChem CID 59043672) has the molecular formula C10H11BF2O2S and a molecular weight of 247.09 g/mol. Its IUPAC name is (2R)-2-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1-(3,4-difluorophenyl)propan-1-one.
| Compound Name | (2R)-2-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1-(3,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 59043672 |
| Molecular Formula | C10H11BF2O2S |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2R)-2-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1-(3,4-difluorophenyl)propan-1-one |
| SMILES | [2H]B([3H])CSO[C@H](C)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H11BF2O2S/c1-6(15-16-5-11)10(14)7-2-3-8(12)9(13)4-7/h2-4,6H,5,11H2,1H3/t6-/m1/s1/i11TD |
| InChIKey | GCVVHQKKQDLQPQ-VSJSELLZSA-N |
| XLogP | 1.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|