C24H38Ac2O8 — CID 59046636
actinium;[(S)-[(1S,5S)-1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl]-[(1S,3R,4S,6R)-1-hydroxy-3-[(2R)-2-hydroxypropanoyl]-3,4-dimethyl-7-oxabicyclo[4.2.0]octan-2-yl]methyl] acetate (PubChem CID 59046636) has the molecular formula C24H38Ac2O8 and a molecular weight of 908.56 g/mol. Its IUPAC name is actinium;[(S)-[(1S,5S)-1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl]-[(1S,3R,4S,6R)-1-hydroxy-3-[(2R)-2-hydroxypropanoyl]-3,4-dimethyl-7-oxabicyclo[4.2.0]octan-2-yl]methyl] acetate.
| Compound Name | actinium;[(S)-[(1S,5S)-1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl]-[(1S,3R,4S,6R)-1-hydroxy-3-[(2R)-2-hydroxypropanoyl]-3,4-dimethyl-7-oxabicyclo[4.2.0]octan-2-yl]methyl] acetate |
|---|---|
| PubChem CID | 59046636 |
| Molecular Formula | C24H38Ac2O8 |
| Molecular Weight | 908.56 g/mol |
| Exact Mass | 908.31 |
| IUPAC Name | actinium;[(S)-[(1S,5S)-1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl]-[(1S,3R,4S,6R)-1-hydroxy-3-[(2R)-2-hydroxypropanoyl]-3,4-dimethyl-7-oxabicyclo[4.2.0]octan-2-yl]methyl] acetate |
| SMILES | CC(=O)OC(C1[C@]2(O)CO[C@@H]2C[C@H](C)[C@@]1(C)C(=O)[C@@H](C)O)[C@]1(O)C[C@H](O)C(C)=CC1(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C24H38O8.2Ac/c1-12-9-21(5,6)24(30,10-16(12)27)20(32-15(4)26)18-22(7,19(28)14(3)25)13(2)8-17-23(18,29)11-31-17;;/h9,13-14,16-18,20,25,27,29-30H,8,10-11H2,1-7H3;;/t13-,14+,16-,17+,18?,20?,22+,23-,24+;;/m0../s1 |
| InChIKey | LPJNCRWDBWOHGK-KUBHDZTBSA-N |
| XLogP | 1.13 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|