C24H36Ac2O8S — CID 59040402
actinium;[(1S,2S,4S,7R,9S,10R,11S,15S)-1,4,11-trihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate (PubChem CID 59040402) has the molecular formula C24H36Ac2O8S and a molecular weight of 940.62 g/mol. Its IUPAC name is actinium;[(1S,2S,4S,7R,9S,10R,11S,15S)-1,4,11-trihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate.
| Compound Name | actinium;[(1S,2S,4S,7R,9S,10R,11S,15S)-1,4,11-trihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
|---|---|
| PubChem CID | 59040402 |
| Molecular Formula | C24H36Ac2O8S |
| Molecular Weight | 940.62 g/mol |
| Exact Mass | 940.28 |
| IUPAC Name | actinium;[(1S,2S,4S,7R,9S,10R,11S,15S)-1,4,11-trihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
| SMILES | [3H]CSO[C@H]1C[C@@]2(O)C(OC(C)=O)C3[C@](C)([C@H](O)C(=O)C(=C1C)C2(C)C)[C@@H](C)C[C@H]1OC[C@@]31O.[Ac].[Ac] |
| InChI | InChI=1S/C24H36O8S.2Ac/c1-11-8-15-23(28,10-30-15)18-20(31-13(3)25)24(29)9-14(32-33-7)12(2)16(21(24,4)5)17(26)19(27)22(11,18)6;;/h11,14-15,18-20,27-29H,8-10H2,1-7H3;;/t11-,14-,15+,18?,19+,20?,22+,23-,24+;;/m0../s1/i7T;; |
| InChIKey | UCVDNVCDSQWMMX-PIHUHSCSSA-N |
| XLogP | 1.79 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|