C26H40O8S — CID 59040390
[(1S,4S,7R,9S,10R,11S,15S)-11-ethoxy-1,4-dihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate (PubChem CID 59040390) has the molecular formula C26H40O8S and a molecular weight of 514.67 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10R,11S,15S)-11-ethoxy-1,4-dihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate.
| Compound Name | [(1S,4S,7R,9S,10R,11S,15S)-11-ethoxy-1,4-dihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
|---|---|
| PubChem CID | 59040390 |
| Molecular Formula | C26H40O8S |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [(1S,4S,7R,9S,10R,11S,15S)-11-ethoxy-1,4-dihydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-(tritiomethylsulfanyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
| SMILES | [3H]CSO[C@H]1C[C@@]2(O)C(OC(C)=O)C3[C@](C)([C@H](OCC)C(=O)C(=C1C)C2(C)C)[C@@H](C)C[C@H]1OC[C@@]31O |
| InChI | InChI=1S/C26H40O8S/c1-9-31-21-19(28)18-14(3)16(34-35-8)11-26(30,23(18,5)6)22(33-15(4)27)20-24(21,7)13(2)10-17-25(20,29)12-32-17/h13,16-17,20-22,29-30H,9-12H2,1-8H3/t13-,16-,17+,20?,21+,22?,24+,25-,26+/m0/s1/i8T |
| InChIKey | SABKZPFSWGLJQR-CLHFDCRHSA-N |
| XLogP | 2.84 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|