C18H32N4O4 — CID 59049740
pentyl (2S)-1-[[[3-(dimethoxymethyl)pyrazol-1-yl]amino]methyl]piperidine-2-carboxylate (PubChem CID 59049740) has the molecular formula C18H32N4O4 and a molecular weight of 368.48 g/mol. Its IUPAC name is pentyl (2S)-1-[[[3-(dimethoxymethyl)pyrazol-1-yl]amino]methyl]piperidine-2-carboxylate.
| Compound Name | pentyl (2S)-1-[[[3-(dimethoxymethyl)pyrazol-1-yl]amino]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 59049740 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | pentyl (2S)-1-[[[3-(dimethoxymethyl)pyrazol-1-yl]amino]methyl]piperidine-2-carboxylate |
| SMILES | CCCCCOC(=O)[C@@H]1CCCCN1CNn1ccc(C(OC)OC)n1 |
| InChI | InChI=1S/C18H32N4O4/c1-4-5-8-13-26-17(23)16-9-6-7-11-21(16)14-19-22-12-10-15(20-22)18(24-2)25-3/h10,12,16,18-19H,4-9,11,13-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | KWYJQURPHXYBHY-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|