C18H29N3O3 — CID 59049705
pentyl (2S)-1-[[(6-methoxy-3-pyridinyl)amino]methyl]piperidine-2-carboxylate (PubChem CID 59049705) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is pentyl (2S)-1-[[(6-methoxy-3-pyridinyl)amino]methyl]piperidine-2-carboxylate.
| Compound Name | pentyl (2S)-1-[[(6-methoxy-3-pyridinyl)amino]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 59049705 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | pentyl (2S)-1-[[(6-methoxy-3-pyridinyl)amino]methyl]piperidine-2-carboxylate |
| SMILES | CCCCCOC(=O)[C@@H]1CCCCN1CNc1ccc(OC)nc1 |
| InChI | InChI=1S/C18H29N3O3/c1-3-4-7-12-24-18(22)16-8-5-6-11-21(16)14-20-15-9-10-17(23-2)19-13-15/h9-10,13,16,20H,3-8,11-12,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | IYFOPUJWAHVSFA-INIZCTEOSA-N |
| XLogP | 3.05 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|