C15H15ClO6 — CID 59052320
2-O-ethyl 4-O-methyl (2R,3R,4R)-3-(4-chlorophenyl)-5-oxooxolane-2,4-dicarboxylate (PubChem CID 59052320) has the molecular formula C15H15ClO6 and a molecular weight of 326.73 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl (2R,3R,4R)-3-(4-chlorophenyl)-5-oxooxolane-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl (2R,3R,4R)-3-(4-chlorophenyl)-5-oxooxolane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 59052320 |
| Molecular Formula | C15H15ClO6 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-O-ethyl 4-O-methyl (2R,3R,4R)-3-(4-chlorophenyl)-5-oxooxolane-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(=O)[C@@H](C(=O)OC)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClO6/c1-3-21-15(19)12-10(8-4-6-9(16)7-5-8)11(13(17)20-2)14(18)22-12/h4-7,10-12H,3H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | JODNWZMLFRQGQR-QJPTWQEYSA-N |
| XLogP | 1.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|