C19H23BrF3N7O3 — CID 59053148
2-[5-[[5-[(6-bromo-1H-indol-3-yl)methyl]-1,2,4-oxadiazol-3-yl]amino]pentyl]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 59053148) has the molecular formula C19H23BrF3N7O3 and a molecular weight of 534.34 g/mol. Its IUPAC name is 2-[5-[[5-[(6-bromo-1H-indol-3-yl)methyl]-1,2,4-oxadiazol-3-yl]amino]pentyl]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[5-[[5-[(6-bromo-1H-indol-3-yl)methyl]-1,2,4-oxadiazol-3-yl]amino]pentyl]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 59053148 |
| Molecular Formula | C19H23BrF3N7O3 |
| Molecular Weight | 534.34 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-[5-[[5-[(6-bromo-1H-indol-3-yl)methyl]-1,2,4-oxadiazol-3-yl]amino]pentyl]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCNc1noc(Cc2c[nH]c3cc(Br)ccc23)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22BrN7O.C2HF3O2/c18-12-4-5-13-11(10-23-14(13)9-12)8-15-24-17(25-26-15)22-7-3-1-2-6-21-16(19)20;3-2(4,5)1(6)7/h4-5,9-10,23H,1-3,6-8H2,(H,22,25)(H4,19,20,21);(H,6,7) |
| InChIKey | DLYSGMZPJTZNEE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|