C21H28N2O4 — CID 59053478
N-(1-adamantyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide (PubChem CID 59053478) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide.
| Compound Name | N-(1-adamantyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 59053478 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-(1-adamantyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)NC12CC3CC(CC(C3)C1)C2)N1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C21H28N2O4/c1-10(23-19(25)16-14-2-3-15(27-14)17(16)20(23)26)18(24)22-21-7-11-4-12(8-21)6-13(5-11)9-21/h10-17H,2-9H2,1H3,(H,22,24) |
| InChIKey | MFTDYJQWPHIYEU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|