C22H23N3 — CID 59054015
6,8-dimethyl-N-(1-naphthalen-1-ylethyl)-4H-quinazolin-1-amine (PubChem CID 59054015) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 6,8-dimethyl-N-(1-naphthalen-1-ylethyl)-4H-quinazolin-1-amine.
| Compound Name | 6,8-dimethyl-N-(1-naphthalen-1-ylethyl)-4H-quinazolin-1-amine |
|---|---|
| PubChem CID | 59054015 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 6,8-dimethyl-N-(1-naphthalen-1-ylethyl)-4H-quinazolin-1-amine |
| SMILES | Cc1cc(C)c2c(c1)CN=CN2NC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H23N3/c1-15-11-16(2)22-19(12-15)13-23-14-25(22)24-17(3)20-10-6-8-18-7-4-5-9-21(18)20/h4-12,14,17,24H,13H2,1-3H3 |
| InChIKey | YTYJUHNCWDRNRO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |