C13H17N3O3S — CID 59055045
(2R,4R,5S)-2-(4-aminobenzimidazol-1-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 59055045) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (2R,4R,5S)-2-(4-aminobenzimidazol-1-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5S)-2-(4-aminobenzimidazol-1-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59055045 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2R,4R,5S)-2-(4-aminobenzimidazol-1-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CSC[C@H]1O[C@@H](n2cnc3c(N)cccc32)C(O)[C@H]1O |
| InChI | InChI=1S/C13H17N3O3S/c1-20-5-9-11(17)12(18)13(19-9)16-6-15-10-7(14)3-2-4-8(10)16/h2-4,6,9,11-13,17-18H,5,14H2,1H3/t9-,11+,12?,13-/m1/s1 |
| InChIKey | XMHOXSQZCCUILU-YJHHQHARSA-N |
| XLogP | 0.60 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|