C22H29NO2P2 — CID 59055829
tert-butyl 4-phenylphosphanyl-2-(phenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 59055829) has the molecular formula C22H29NO2P2 and a molecular weight of 401.43 g/mol. Its IUPAC name is tert-butyl 4-phenylphosphanyl-2-(phenylphosphanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-phenylphosphanyl-2-(phenylphosphanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59055829 |
| Molecular Formula | C22H29NO2P2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl 4-phenylphosphanyl-2-(phenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Pc2ccccc2)CC1CPc1ccccc1 |
| InChI | InChI=1S/C22H29NO2P2/c1-22(2,3)25-21(24)23-15-20(27-19-12-8-5-9-13-19)14-17(23)16-26-18-10-6-4-7-11-18/h4-13,17,20,26-27H,14-16H2,1-3H3 |
| InChIKey | SIIRZVDLZAPNHQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|