C27H35O5P — CID 59056998
(1R,2R,3aS,8bS)-5-(2-dimethylphosphorylethyl)-1-[(E,3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol (PubChem CID 59056998) has the molecular formula C27H35O5P and a molecular weight of 470.55 g/mol. Its IUPAC name is (1R,2R,3aS,8bS)-5-(2-dimethylphosphorylethyl)-1-[(E,3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol.
| Compound Name | (1R,2R,3aS,8bS)-5-(2-dimethylphosphorylethyl)-1-[(E,3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
|---|---|
| PubChem CID | 59056998 |
| Molecular Formula | C27H35O5P |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (1R,2R,3aS,8bS)-5-(2-dimethylphosphorylethyl)-1-[(E,3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
| SMILES | CC(C)(Oc1ccccc1)[C@H](O)/C=C/[C@@H]1[C@H]2c3cccc(CCP(C)(C)=O)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H35O5P/c1-27(2,32-19-10-6-5-7-11-19)24(29)14-13-20-22(28)17-23-25(20)21-12-8-9-18(26(21)31-23)15-16-33(3,4)30/h5-14,20,22-25,28-29H,15-17H2,1-4H3/b14-13+/t20-,22+,23-,24+,25-/m0/s1 |
| InChIKey | GLZASZFETUYQQT-RWJYBYLNSA-N |
| XLogP | 4.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|