C26H31N3O4 — CID 90898165
(1R,2R,3aS,8bS)-5-(3-azidopropyl)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol (PubChem CID 90898165) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1R,2R,3aS,8bS)-5-(3-azidopropyl)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol.
| Compound Name | (1R,2R,3aS,8bS)-5-(3-azidopropyl)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
|---|---|
| PubChem CID | 90898165 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (1R,2R,3aS,8bS)-5-(3-azidopropyl)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
| SMILES | CC(C)(Oc1ccccc1)[C@H](O)C=C[C@@H]1[C@H]2c3cccc(CCCN=[N+]=[N-])c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H31N3O4/c1-26(2,33-18-10-4-3-5-11-18)23(31)14-13-19-21(30)16-22-24(19)20-12-6-8-17(25(20)32-22)9-7-15-28-29-27/h3-6,8,10-14,19,21-24,30-31H,7,9,15-16H2,1-2H3/t19-,21+,22-,23+,24-/m0/s1 |
| InChIKey | XFJZGRQSIDPXPL-IBXSQZDTSA-N |
| XLogP | 4.93 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|