C27H31F3O5 — CID 90852624
(1R,2R,3aS,8bS)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-5-(4,4,4-trifluoro-3-hydroxybutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol (PubChem CID 90852624) has the molecular formula C27H31F3O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is (1R,2R,3aS,8bS)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-5-(4,4,4-trifluoro-3-hydroxybutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol.
| Compound Name | (1R,2R,3aS,8bS)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-5-(4,4,4-trifluoro-3-hydroxybutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
|---|---|
| PubChem CID | 90852624 |
| Molecular Formula | C27H31F3O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (1R,2R,3aS,8bS)-1-[(3R)-3-hydroxy-4-methyl-4-phenoxypent-1-enyl]-5-(4,4,4-trifluoro-3-hydroxybutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
| SMILES | CC(C)(Oc1ccccc1)[C@H](O)C=C[C@@H]1[C@H]2c3cccc(CCC(O)C(F)(F)F)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H31F3O5/c1-26(2,35-17-8-4-3-5-9-17)22(32)14-12-18-20(31)15-21-24(18)19-10-6-7-16(25(19)34-21)11-13-23(33)27(28,29)30/h3-10,12,14,18,20-24,31-33H,11,13,15H2,1-2H3/t18-,20+,21-,22+,23?,24-/m0/s1 |
| InChIKey | RMEOHFUMFOBEJT-SZKDLUKNSA-N |
| XLogP | 4.54 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|