C12H20O4 — CID 59059204
ethyl (Z)-3-(deuteriomethoxy)-4,4-dimethyl-5-oxohept-2-enoate (PubChem CID 59059204) has the molecular formula C12H20O4 and a molecular weight of 229.29 g/mol. Its IUPAC name is ethyl (Z)-3-(deuteriomethoxy)-4,4-dimethyl-5-oxohept-2-enoate.
| Compound Name | ethyl (Z)-3-(deuteriomethoxy)-4,4-dimethyl-5-oxohept-2-enoate |
|---|---|
| PubChem CID | 59059204 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | ethyl (Z)-3-(deuteriomethoxy)-4,4-dimethyl-5-oxohept-2-enoate |
| SMILES | [2H]CO/C(=C\C(=O)OCC)C(C)(C)C(=O)CC |
| InChI | InChI=1S/C12H20O4/c1-6-9(13)12(3,4)10(15-5)8-11(14)16-7-2/h8H,6-7H2,1-5H3/b10-8-/i5D |
| InChIKey | FVJSMKRHQSNRSW-OHWLGVOBSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|