C29H36FNO6Si — CID 59059618
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R,11E)-11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059618) has the molecular formula C29H36FNO6Si and a molecular weight of 541.69 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R,11E)-11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R,11E)-11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059618 |
| Molecular Formula | C29H36FNO6Si |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R,11E)-11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1C(C(=O)OCC[Si](C)(C)C)C2C/C(=N\OCc3ccc(F)cc3)[C@H]1c1cc(O)ccc12 |
| InChI | InChI=1S/C29H36FNO6Si/c1-5-12-35-29(34)27-25-22-15-20(32)10-11-21(22)23(26(27)28(33)36-13-14-38(2,3)4)16-24(25)31-37-17-18-6-8-19(30)9-7-18/h6-11,15,23,25-27,32H,5,12-14,16-17H2,1-4H3/b31-24+/t23?,25-,26?,27-/m1/s1 |
| InChIKey | ZVVYYJYDHKPYME-OPBCMDLCSA-N |
| XLogP | 5.76 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|