C24H39N3O4 — CID 59065685
(2S)-N-[(3S)-1-(benzylamino)-2-hydroxy-1-oxooctan-3-yl]-2-methyl-N'-propylpentanediamide (PubChem CID 59065685) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-(benzylamino)-2-hydroxy-1-oxooctan-3-yl]-2-methyl-N'-propylpentanediamide.
| Compound Name | (2S)-N-[(3S)-1-(benzylamino)-2-hydroxy-1-oxooctan-3-yl]-2-methyl-N'-propylpentanediamide |
|---|---|
| PubChem CID | 59065685 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | (2S)-N-[(3S)-1-(benzylamino)-2-hydroxy-1-oxooctan-3-yl]-2-methyl-N'-propylpentanediamide |
| SMILES | CCCCC[C@H](NC(=O)[C@@H](C)CCC(=O)NCCC)C(O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H39N3O4/c1-4-6-8-13-20(22(29)24(31)26-17-19-11-9-7-10-12-19)27-23(30)18(3)14-15-21(28)25-16-5-2/h7,9-12,18,20,22,29H,4-6,8,13-17H2,1-3H3,(H,25,28)(H,26,31)(H,27,30)/t18-,20-,22?/m0/s1 |
| InChIKey | IOOYESUQZHQHTE-LCODYBDSSA-N |
| XLogP | 2.67 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|