C27H35NO7 — CID 59065911
ethyl (2S,3S)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(dibenzylamino)-3-hydroxypropanoate (PubChem CID 59065911) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(dibenzylamino)-3-hydroxypropanoate.
| Compound Name | ethyl (2S,3S)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(dibenzylamino)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 59065911 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | ethyl (2S,3S)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(dibenzylamino)-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H]([C@H](O)[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@H]12)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H35NO7/c1-5-32-25(30)20(21(29)22-23-24(26(31-4)33-22)35-27(2,3)34-23)28(16-18-12-8-6-9-13-18)17-19-14-10-7-11-15-19/h6-15,20-24,26,29H,5,16-17H2,1-4H3/t20-,21-,22+,23+,24+,26+/m0/s1 |
| InChIKey | QOWZSSQNPZCOAY-GSHSSDCSSA-N |
| XLogP | 2.87 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |