C12H22O5 — CID 59068310
1-[(3R,4R)-3,4,5-trihydroxy-3,4,5,6,6-pentamethyloxan-2-yl]ethanone (PubChem CID 59068310) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 1-[(3R,4R)-3,4,5-trihydroxy-3,4,5,6,6-pentamethyloxan-2-yl]ethanone.
| Compound Name | 1-[(3R,4R)-3,4,5-trihydroxy-3,4,5,6,6-pentamethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 59068310 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-[(3R,4R)-3,4,5-trihydroxy-3,4,5,6,6-pentamethyloxan-2-yl]ethanone |
| SMILES | CC(=O)C1OC(C)(C)C(C)(O)[C@](C)(O)[C@]1(C)O |
| InChI | InChI=1S/C12H22O5/c1-7(13)8-10(4,14)12(6,16)11(5,15)9(2,3)17-8/h8,14-16H,1-6H3/t8?,10-,11?,12-/m1/s1 |
| InChIKey | DNWOXLRGVWIEQK-QBXIENIFSA-N |
| XLogP | 0.01 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |