C7H13N3O — CID 59068377
1-(1H-imidazol-5-yl)-N-methyl-3-tritiooxypropan-2-amine (PubChem CID 59068377) has the molecular formula C7H13N3O and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-methyl-3-tritiooxypropan-2-amine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-methyl-3-tritiooxypropan-2-amine |
|---|---|
| PubChem CID | 59068377 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-methyl-3-tritiooxypropan-2-amine |
| SMILES | [3H]OCC(Cc1cnc[nH]1)NC |
| InChI | InChI=1S/C7H13N3O/c1-8-7(4-11)2-6-3-9-5-10-6/h3,5,7-8,11H,2,4H2,1H3,(H,9,10)/i11T |
| InChIKey | MQPNGCUDSUWPCW-KNWSOFMKSA-N |
| XLogP | -0.47 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |