C12H10Pr2-2 — CID 59074422
2,3-dimethyl-1,4-dihydronaphthalene-1,4-diide;praseodymium (PubChem CID 59074422) has the molecular formula C12H10Pr2-2 and a molecular weight of 436.03 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydronaphthalene-1,4-diide;praseodymium.
| Compound Name | 2,3-dimethyl-1,4-dihydronaphthalene-1,4-diide;praseodymium |
|---|---|
| PubChem CID | 59074422 |
| Molecular Formula | C12H10Pr2-2 |
| Molecular Weight | 436.03 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydronaphthalene-1,4-diide;praseodymium |
| SMILES | Cc1[c-]c2ccccc2[c-]c1C.[Pr].[Pr] |
| InChI | InChI=1S/C12H10.2Pr/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;;/h3-6H,1-2H3;;/q-2;; |
| InChIKey | QDNVEXHZHCKTSY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.03 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|