C12H16NW- — CID 159784775
1,2-dimethyl-3H-indol-3-ide;ethane;tungsten (PubChem CID 159784775) has the molecular formula C12H16NW- and a molecular weight of 358.11 g/mol. Its IUPAC name is 1,2-dimethyl-3H-indol-3-ide;ethane;tungsten.
| Compound Name | 1,2-dimethyl-3H-indol-3-ide;ethane;tungsten |
|---|---|
| PubChem CID | 159784775 |
| Molecular Formula | C12H16NW- |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1,2-dimethyl-3H-indol-3-ide;ethane;tungsten |
| SMILES | CC.Cc1[c-]c2ccccc2n1C.[W] |
| InChI | InChI=1S/C10H10N.C2H6.W/c1-8-7-9-5-3-4-6-10(9)11(8)2;1-2;/h3-6H,1-2H3;1-2H3;/q-1;; |
| InChIKey | AFFOVXBPZTXZRX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|