C16H27NO3 — CID 59076478
N-[(1R,2R,6R)-4-methyl-6-(2-oxoethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076478) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(1R,2R,6R)-4-methyl-6-(2-oxoethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-4-methyl-6-(2-oxoethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076478 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[(1R,2R,6R)-4-methyl-6-(2-oxoethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](CC=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C16H27NO3/c1-5-14(6-2)20-15-10-11(3)9-13(7-8-18)16(15)17-12(4)19/h8,10,13-16H,5-7,9H2,1-4H3,(H,17,19)/t13-,15+,16+/m0/s1 |
| InChIKey | LKRQRGXKSAZCDA-NUEKZKHPSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|