C14H25NO3 — CID 59076479
N-[(1R,2R,6R)-6-(2-hydroxyethyl)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076479) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[(1R,2R,6R)-6-(2-hydroxyethyl)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-6-(2-hydroxyethyl)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076479 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(1R,2R,6R)-6-(2-hydroxyethyl)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](CCO)CC(C)=C[C@H]1OC(C)C |
| InChI | InChI=1S/C14H25NO3/c1-9(2)18-13-8-10(3)7-12(5-6-16)14(13)15-11(4)17/h8-9,12-14,16H,5-7H2,1-4H3,(H,15,17)/t12-,13+,14+/m0/s1 |
| InChIKey | ZELOLHJNKKSOQH-BFHYXJOUSA-N |
| XLogP | 1.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|