C17H30N4O3 — CID 59076522
N-[(1R,2R,6R)-6-(3-azido-2-hydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076522) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(1R,2R,6R)-6-(3-azido-2-hydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-6-(3-azido-2-hydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076522 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | N-[(1R,2R,6R)-6-(3-azido-2-hydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](CC(O)CN=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H30N4O3/c1-5-15(6-2)24-16-8-11(3)7-13(17(16)20-12(4)22)9-14(23)10-19-21-18/h8,13-17,23H,5-7,9-10H2,1-4H3,(H,20,22)/t13-,14?,16-,17-/m1/s1 |
| InChIKey | CEOBGSMRXRUXGP-KLCSZFHISA-N |
| XLogP | 3.09 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|