C11H20O6 — CID 59078242
methyl (2S,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 59078242) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 59078242 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20O6/c1-11(2,3)9-7(14)5(12)6(13)8(17-9)10(15)16-4/h5-9,12-14H,1-4H3/t5-,6-,7+,8-,9+/m0/s1 |
| InChIKey | RGQCMUFBAXLTNG-VRGHQRLXSA-N |
| XLogP | -0.94 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |