C32H26F6N4O6 — CID 590788
methyl 3-[7-[3-methoxy-3-oxo-2-[(2,2,2-trifluoroacetyl)amino]propyl]-6,13-dihydroquinolino[2,3-b]acridin-1-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 590788) has the molecular formula C32H26F6N4O6 and a molecular weight of 676.57 g/mol. Its IUPAC name is methyl 3-[7-[3-methoxy-3-oxo-2-[(2,2,2-trifluoroacetyl)amino]propyl]-6,13-dihydroquinolino[2,3-b]acridin-1-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl 3-[7-[3-methoxy-3-oxo-2-[(2,2,2-trifluoroacetyl)amino]propyl]-6,13-dihydroquinolino[2,3-b]acridin-1-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 590788 |
| Molecular Formula | C32H26F6N4O6 |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | methyl 3-[7-[3-methoxy-3-oxo-2-[(2,2,2-trifluoroacetyl)amino]propyl]-6,13-dihydroquinolino[2,3-b]acridin-1-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)C(Cc1cccc2nc3c(cc12)Cc1nc2ccccc2c(CC(NC(=O)C(F)(F)F)C(=O)OC)c1C3)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C32H26F6N4O6/c1-47-27(43)25(41-29(45)31(33,34)35)11-15-6-5-9-22-18(15)10-16-12-24-20(14-23(16)39-22)19(17-7-3-4-8-21(17)40-24)13-26(28(44)48-2)42-30(46)32(36,37)38/h3-10,25-26H,11-14H2,1-2H3,(H,41,45)(H,42,46) |
| InChIKey | IGNKICDWOKCQBK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |