C19H34NP — CID 59080054
N-(1-ditert-butylphosphanylpropan-2-yl)-2,6-dimethylaniline (PubChem CID 59080054) has the molecular formula C19H34NP and a molecular weight of 307.46 g/mol. Its IUPAC name is N-(1-ditert-butylphosphanylpropan-2-yl)-2,6-dimethylaniline.
| Compound Name | N-(1-ditert-butylphosphanylpropan-2-yl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 59080054 |
| Molecular Formula | C19H34NP |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-(1-ditert-butylphosphanylpropan-2-yl)-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NC(C)CP(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H34NP/c1-14-11-10-12-15(2)17(14)20-16(3)13-21(18(4,5)6)19(7,8)9/h10-12,16,20H,13H2,1-9H3 |
| InChIKey | YEJBQRWJKBVNAC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|