C12H18N2S — CID 82080364
3-(2,6-dimethylanilino)butanethioamide (PubChem CID 82080364) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 3-(2,6-dimethylanilino)butanethioamide.
| Compound Name | 3-(2,6-dimethylanilino)butanethioamide |
|---|---|
| PubChem CID | 82080364 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-(2,6-dimethylanilino)butanethioamide |
| SMILES | Cc1cccc(C)c1NC(C)CC(N)=S |
| InChI | InChI=1S/C12H18N2S/c1-8-5-4-6-9(2)12(8)14-10(3)7-11(13)15/h4-6,10,14H,7H2,1-3H3,(H2,13,15) |
| InChIKey | FPHPEDNIQAGULL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|