C54H76N4O10 — CID 59081786
[4-[3-[2,2-bis(hexanoyloxymethyl)-1,3,6a,9b-tetrahydroperimidin-4-yl]-2,4-dihydroxycyclobutyl]-2-(hexanoyloxymethyl)-1,3,3a,4-tetrahydroperimidin-2-yl]methyl hexanoate (PubChem CID 59081786) has the molecular formula C54H76N4O10 and a molecular weight of 941.22 g/mol. Its IUPAC name is [4-[3-[2,2-bis(hexanoyloxymethyl)-1,3,6a,9b-tetrahydroperimidin-4-yl]-2,4-dihydroxycyclobutyl]-2-(hexanoyloxymethyl)-1,3,3a,4-tetrahydroperimidin-2-yl]methyl hexanoate.
| Compound Name | [4-[3-[2,2-bis(hexanoyloxymethyl)-1,3,6a,9b-tetrahydroperimidin-4-yl]-2,4-dihydroxycyclobutyl]-2-(hexanoyloxymethyl)-1,3,3a,4-tetrahydroperimidin-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 59081786 |
| Molecular Formula | C54H76N4O10 |
| Molecular Weight | 941.22 g/mol |
| Exact Mass | 940.56 |
| IUPAC Name | [4-[3-[2,2-bis(hexanoyloxymethyl)-1,3,6a,9b-tetrahydroperimidin-4-yl]-2,4-dihydroxycyclobutyl]-2-(hexanoyloxymethyl)-1,3,3a,4-tetrahydroperimidin-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCC1(COC(=O)CCCCC)NC2=CC=CC3C=CC(C4C(O)C(C5C=Cc6cccc7c6C5NC(COC(=O)CCCCC)(COC(=O)CCCCC)N7)C4O)=C(N1)C23 |
| InChI | InChI=1S/C54H76N4O10/c1-5-9-13-23-41(59)65-31-53(32-66-42(60)24-14-10-6-2)55-39-21-17-19-35-27-29-37(49(57-53)45(35)39)47-51(63)48(52(47)64)38-30-28-36-20-18-22-40-46(36)50(38)58-54(56-40,33-67-43(61)25-15-11-7-3)34-68-44(62)26-16-12-8-4/h17-22,27-30,35,38,45,47-48,50-52,55-58,63-64H,5-16,23-26,31-34H2,1-4H3 |
| InChIKey | HPGGBGGQDRLYDK-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 193.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.22 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|