C8H16F3N2O4P — CID 59082791
[[hydroxy(5,5,5-trifluoropentanoyl)amino]methylamino]methyl-methylphosphinic acid (PubChem CID 59082791) has the molecular formula C8H16F3N2O4P and a molecular weight of 292.19 g/mol. Its IUPAC name is [[hydroxy(5,5,5-trifluoropentanoyl)amino]methylamino]methyl-methylphosphinic acid.
| Compound Name | [[hydroxy(5,5,5-trifluoropentanoyl)amino]methylamino]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 59082791 |
| Molecular Formula | C8H16F3N2O4P |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [[hydroxy(5,5,5-trifluoropentanoyl)amino]methylamino]methyl-methylphosphinic acid |
| SMILES | CP(=O)(O)CNCN(O)C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H16F3N2O4P/c1-18(16,17)6-12-5-13(15)7(14)3-2-4-8(9,10)11/h12,15H,2-6H2,1H3,(H,16,17) |
| InChIKey | FTJLUTIBMHILOW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|