C13H26F3N2O4P — CID 59082881
1-[1-[hydroxy(5,5,5-trifluoropentanoyl)amino]ethyl-propan-2-ylamino]ethyl-methylphosphinic acid (PubChem CID 59082881) has the molecular formula C13H26F3N2O4P and a molecular weight of 362.33 g/mol. Its IUPAC name is 1-[1-[hydroxy(5,5,5-trifluoropentanoyl)amino]ethyl-propan-2-ylamino]ethyl-methylphosphinic acid.
| Compound Name | 1-[1-[hydroxy(5,5,5-trifluoropentanoyl)amino]ethyl-propan-2-ylamino]ethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 59082881 |
| Molecular Formula | C13H26F3N2O4P |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-[1-[hydroxy(5,5,5-trifluoropentanoyl)amino]ethyl-propan-2-ylamino]ethyl-methylphosphinic acid |
| SMILES | CC(C)N(C(C)N(O)C(=O)CCCC(F)(F)F)C(C)P(C)(=O)O |
| InChI | InChI=1S/C13H26F3N2O4P/c1-9(2)17(11(4)23(5,21)22)10(3)18(20)12(19)7-6-8-13(14,15)16/h9-11,20H,6-8H2,1-5H3,(H,21,22) |
| InChIKey | GYSNVDAATRTWNM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|