C39H43N2O6S4- — CID 59086699
4-[2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)-6-thiophen-2-ylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-6-thiophen-2-ylindol-1-yl]butane-1-sulfonate (PubChem CID 59086699) has the molecular formula C39H43N2O6S4- and a molecular weight of 764.05 g/mol. Its IUPAC name is 4-[2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)-6-thiophen-2-ylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-6-thiophen-2-ylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)-6-thiophen-2-ylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-6-thiophen-2-ylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59086699 |
| Molecular Formula | C39H43N2O6S4- |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.20 |
| IUPAC Name | 4-[2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)-6-thiophen-2-ylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-6-thiophen-2-ylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCCS(=O)(=O)[O-])c3cc(-c4cccs4)ccc3C2(C)C)N(CCCCS(=O)(=O)[O-])c2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C39H44N2O6S4/c1-38(2)30-18-16-28(34-12-10-22-48-34)26-32(30)40(20-5-7-24-50(42,43)44)36(38)14-9-15-37-39(3,4)31-19-17-29(35-13-11-23-49-35)27-33(31)41(37)21-6-8-25-51(45,46)47/h9-19,22-23,26-27H,5-8,20-21,24-25H2,1-4H3,(H-,42,43,44,45,46,47)/p-1 |
| InChIKey | SOYPFKLMXMGVFC-UHFFFAOYSA-M |
| XLogP | 8.41 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|