C20H25F5N2O5 — CID 59087224
(2,3,4,5,6-pentafluorophenyl) 2-[[(2R)-4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate (PubChem CID 59087224) has the molecular formula C20H25F5N2O5 and a molecular weight of 468.42 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[[(2R)-4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[[(2R)-4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 59087224 |
| Molecular Formula | C20H25F5N2O5 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[[(2R)-4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate |
| SMILES | CC(C)(C)C[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H25F5N2O5/c1-19(2,3)7-9(27-18(30)32-20(4,5)6)17(29)26-8-10(28)31-16-14(24)12(22)11(21)13(23)15(16)25/h9H,7-8H2,1-6H3,(H,26,29)(H,27,30)/t9-/m1/s1 |
| InChIKey | KUUICSFCHNRWHL-SECBINFHSA-N |
| XLogP | 3.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|