C31H50O10 — CID 59087626
3-O,7-O-dibutyl 5-O-methyl 1,11-bis(2-methylprop-2-enoyloxy)undecane-3,5,7-tricarboxylate (PubChem CID 59087626) has the molecular formula C31H50O10 and a molecular weight of 582.73 g/mol. Its IUPAC name is 3-O,7-O-dibutyl 5-O-methyl 1,11-bis(2-methylprop-2-enoyloxy)undecane-3,5,7-tricarboxylate.
| Compound Name | 3-O,7-O-dibutyl 5-O-methyl 1,11-bis(2-methylprop-2-enoyloxy)undecane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 59087626 |
| Molecular Formula | C31H50O10 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | 3-O,7-O-dibutyl 5-O-methyl 1,11-bis(2-methylprop-2-enoyloxy)undecane-3,5,7-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCCC(CC(CC(CCCOC(=O)C(=C)C)C(=O)OCCCC)C(=O)OC)C(=O)OCCCC |
| InChI | InChI=1S/C31H50O10/c1-8-10-16-40-30(35)24(14-12-18-38-27(32)22(3)4)20-26(29(34)37-7)21-25(31(36)41-17-11-9-2)15-13-19-39-28(33)23(5)6/h24-26H,3,5,8-21H2,1-2,4,6-7H3 |
| InChIKey | YXJZLPKNPDVZRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|