C20H34N2O2 — CID 59090172
7-(6-amino-2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)heptane-1,2-diol (PubChem CID 59090172) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is 7-(6-amino-2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)heptane-1,2-diol.
| Compound Name | 7-(6-amino-2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)heptane-1,2-diol |
|---|---|
| PubChem CID | 59090172 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 7-(6-amino-2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)heptane-1,2-diol |
| SMILES | Cc1cc2c(cc1N)C(C)CC(C)(C)N2CCCCCC(O)CO |
| InChI | InChI=1S/C20H34N2O2/c1-14-10-19-17(11-18(14)21)15(2)12-20(3,4)22(19)9-7-5-6-8-16(24)13-23/h10-11,15-16,23-24H,5-9,12-13,21H2,1-4H3 |
| InChIKey | AOKVJDRPTYEEHH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|