C42H52ClN4O10PS — CID 59093012
dibenzyl [(2R,3S)-3-[[(2S)-2-[(2-chloroacetyl)amino]-3,3-dimethylbutanoyl]amino]-1-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate (PubChem CID 59093012) has the molecular formula C42H52ClN4O10PS and a molecular weight of 871.39 g/mol. Its IUPAC name is dibenzyl [(2R,3S)-3-[[(2S)-2-[(2-chloroacetyl)amino]-3,3-dimethylbutanoyl]amino]-1-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate.
| Compound Name | dibenzyl [(2R,3S)-3-[[(2S)-2-[(2-chloroacetyl)amino]-3,3-dimethylbutanoyl]amino]-1-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate |
|---|---|
| PubChem CID | 59093012 |
| Molecular Formula | C42H52ClN4O10PS |
| Molecular Weight | 871.39 g/mol |
| Exact Mass | 870.28 |
| IUPAC Name | dibenzyl [(2R,3S)-3-[[(2S)-2-[(2-chloroacetyl)amino]-3,3-dimethylbutanoyl]amino]-1-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate |
| SMILES | CC(C)CN(C[C@@H](OP(=O)(OCc1ccccc1)OCc1ccccc1)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CCl)C(C)(C)C)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C42H52ClN4O10PS/c1-31(2)27-46(59(53,54)36-23-15-22-35(25-36)47(50)51)28-38(57-58(52,55-29-33-18-11-7-12-19-33)56-30-34-20-13-8-14-21-34)37(24-32-16-9-6-10-17-32)44-41(49)40(42(3,4)5)45-39(48)26-43/h6-23,25,31,37-38,40H,24,26-30H2,1-5H3,(H,44,49)(H,45,48)/t37-,38+,40+/m0/s1 |
| InChIKey | NIVLVJJQBSHCMC-PQTOBSADSA-N |
| XLogP | 7.67 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.39 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|