C28H44O2Si2 — CID 59096246
3,5,5,6,6,8-hexamethyl-4,7-dipentoxybenzo[c][1,2]benzodisiline (PubChem CID 59096246) has the molecular formula C28H44O2Si2 and a molecular weight of 468.83 g/mol. Its IUPAC name is 3,5,5,6,6,8-hexamethyl-4,7-dipentoxybenzo[c][1,2]benzodisiline.
| Compound Name | 3,5,5,6,6,8-hexamethyl-4,7-dipentoxybenzo[c][1,2]benzodisiline |
|---|---|
| PubChem CID | 59096246 |
| Molecular Formula | C28H44O2Si2 |
| Molecular Weight | 468.83 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3,5,5,6,6,8-hexamethyl-4,7-dipentoxybenzo[c][1,2]benzodisiline |
| SMILES | CCCCCOc1c(C)ccc2c1[Si](C)(C)[Si](C)(C)c1c-2ccc(C)c1OCCCCC |
| InChI | InChI=1S/C28H44O2Si2/c1-9-11-13-19-29-25-21(3)15-17-23-24-18-16-22(4)26(30-20-14-12-10-2)28(24)32(7,8)31(5,6)27(23)25/h15-18H,9-14,19-20H2,1-8H3 |
| InChIKey | OKWUOUORMDCQDZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.83 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|