C40H56O2S2 — CID 121308594
2-(1,5-didecoxy-6-methylnaphthalen-2-yl)-5-(5-methylthiophen-2-yl)thiophene (PubChem CID 121308594) has the molecular formula C40H56O2S2 and a molecular weight of 633.02 g/mol. Its IUPAC name is 2-(1,5-didecoxy-6-methylnaphthalen-2-yl)-5-(5-methylthiophen-2-yl)thiophene.
| Compound Name | 2-(1,5-didecoxy-6-methylnaphthalen-2-yl)-5-(5-methylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 121308594 |
| Molecular Formula | C40H56O2S2 |
| Molecular Weight | 633.02 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | 2-(1,5-didecoxy-6-methylnaphthalen-2-yl)-5-(5-methylthiophen-2-yl)thiophene |
| SMILES | CCCCCCCCCCOc1c(C)ccc2c(OCCCCCCCCCC)c(-c3ccc(-c4ccc(C)s4)s3)ccc12 |
| InChI | InChI=1S/C40H56O2S2/c1-5-7-9-11-13-15-17-19-29-41-39-31(3)21-23-34-33(39)24-25-35(36-27-28-38(44-36)37-26-22-32(4)43-37)40(34)42-30-20-18-16-14-12-10-8-6-2/h21-28H,5-20,29-30H2,1-4H3 |
| InChIKey | JVBQSWUIIVJOFI-UHFFFAOYSA-N |
| XLogP | 13.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.02 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|