C21H22F4N2O7S — CID 59096985
6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]sulfonyl-N-hydroxy-2,3-dimethoxybenzamide (PubChem CID 59096985) has the molecular formula C21H22F4N2O7S and a molecular weight of 522.47 g/mol. Its IUPAC name is 6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]sulfonyl-N-hydroxy-2,3-dimethoxybenzamide.
| Compound Name | 6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]sulfonyl-N-hydroxy-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 59096985 |
| Molecular Formula | C21H22F4N2O7S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]sulfonyl-N-hydroxy-2,3-dimethoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(c3ccc(OC(F)(F)F)c(F)c3)CC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C21H22F4N2O7S/c1-32-16-5-6-17(18(19(16)33-2)20(28)26-29)35(30,31)27-9-7-12(8-10-27)13-3-4-15(14(22)11-13)34-21(23,24)25/h3-6,11-12,29H,7-10H2,1-2H3,(H,26,28) |
| InChIKey | XDBQGKMNHUWFAI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|