C13H19N3O6S — CID 20626166
N-hydroxy-2,3-dimethoxy-6-piperazin-1-ylsulfonylbenzamide (PubChem CID 20626166) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-piperazin-1-ylsulfonylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-piperazin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 20626166 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-piperazin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCNCC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C13H19N3O6S/c1-21-9-3-4-10(11(12(9)22-2)13(17)15-18)23(19,20)16-7-5-14-6-8-16/h3-4,14,18H,5-8H2,1-2H3,(H,15,17) |
| InChIKey | DBPMWFJVUJLYLQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|