C17H17N3O6S — CID 59102781
N-[5-oxo-1-[4-phenoxy-3-(trihydroxy-λ4-sulfanyl)phenyl]-4H-pyrazol-3-yl]acetamide (PubChem CID 59102781) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-[5-oxo-1-[4-phenoxy-3-(trihydroxy-λ4-sulfanyl)phenyl]-4H-pyrazol-3-yl]acetamide.
| Compound Name | N-[5-oxo-1-[4-phenoxy-3-(trihydroxy-λ4-sulfanyl)phenyl]-4H-pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 59102781 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[5-oxo-1-[4-phenoxy-3-(trihydroxy-λ4-sulfanyl)phenyl]-4H-pyrazol-3-yl]acetamide |
| SMILES | CC(=O)NC1=NN(c2ccc(Oc3ccccc3)c(S(O)(O)O)c2)C(=O)C1 |
| InChI | InChI=1S/C17H17N3O6S/c1-11(21)18-16-10-17(22)20(19-16)12-7-8-14(15(9-12)27(23,24)25)26-13-5-3-2-4-6-13/h2-9,23-25H,10H2,1H3,(H,18,19,21) |
| InChIKey | LJMCDTNGUNNRNM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|