C22H25N3O3S — CID 59103258
4-isocyano-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide (PubChem CID 59103258) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-isocyano-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide.
| Compound Name | 4-isocyano-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59103258 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-isocyano-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2ccc([C@H]3CCC[C@H]3NS(=O)(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-15(2)29(27,28)25-21-6-4-5-20(21)16-7-13-19(14-8-16)24-22(26)17-9-11-18(23-3)12-10-17/h7-15,20-21,25H,4-6H2,1-2H3,(H,24,26)/t20-,21-/m1/s1 |
| InChIKey | LZCKRIDITVVKLU-NHCUHLMSSA-N |
| XLogP | 4.45 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|